C14H27N2O+ — CID 23306656
3-[[(1S,2S,4R)-bicyclo[2.2.1]heptane-2-carbonyl]amino]propyl-trimethylazanium (PubChem CID 23306656) has the molecular formula C14H27N2O+ and a molecular weight of 239.38 g/mol. Its IUPAC name is 3-[[(1S,2S,4R)-bicyclo[2.2.1]heptane-2-carbonyl]amino]propyl-trimethylazanium.
| Compound Name | 3-[[(1S,2S,4R)-bicyclo[2.2.1]heptane-2-carbonyl]amino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 23306656 |
| Molecular Formula | C14H27N2O+ |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.21 |
| IUPAC Name | 3-[[(1S,2S,4R)-bicyclo[2.2.1]heptane-2-carbonyl]amino]propyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCCNC(=O)[C@H]1C[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C14H26N2O/c1-16(2,3)8-4-7-15-14(17)13-10-11-5-6-12(13)9-11/h11-13H,4-10H2,1-3H3/p+1/t11-,12+,13+/m1/s1 |
| InChIKey | ATPREZXWWGWYMJ-AGIUHOORSA-O |
| XLogP | 1.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|