C16H11ClNO6- — CID 23307006
5-[(3aR,4S,7S,7aR)-7-(hydroxymethyl)-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]-2-chlorobenzoate (PubChem CID 23307006) has the molecular formula C16H11ClNO6- and a molecular weight of 348.72 g/mol. Its IUPAC name is 5-[(3aR,4S,7S,7aR)-7-(hydroxymethyl)-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]-2-chlorobenzoate.
| Compound Name | 5-[(3aR,4S,7S,7aR)-7-(hydroxymethyl)-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 23307006 |
| Molecular Formula | C16H11ClNO6- |
| Molecular Weight | 348.72 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 5-[(3aR,4S,7S,7aR)-7-(hydroxymethyl)-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]-2-chlorobenzoate |
| SMILES | O=C([O-])c1cc(N2C(=O)[C@H]3[C@@H]4C=C[C@](CO)(O4)[C@@H]3C2=O)ccc1Cl |
| InChI | InChI=1S/C16H12ClNO6/c17-9-2-1-7(5-8(9)15(22)23)18-13(20)11-10-3-4-16(6-19,24-10)12(11)14(18)21/h1-5,10-12,19H,6H2,(H,22,23)/p-1/t10-,11-,12-,16+/m0/s1 |
| InChIKey | GAJGJZDRSISUGB-CENBSLRLSA-M |
| XLogP | -0.49 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.72 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|