C19H19N5OS2 — CID 2330711
2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)acetonitrile (PubChem CID 2330711) has the molecular formula C19H19N5OS2 and a molecular weight of 397.53 g/mol. Its IUPAC name is 2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)acetonitrile.
| Compound Name | 2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)acetonitrile |
|---|---|
| PubChem CID | 2330711 |
| Molecular Formula | C19H19N5OS2 |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)acetonitrile |
| SMILES | CC1=C(C)SC(=C(C#N)c2nnc(N3CCOCC3)n2-c2ccccc2)S1 |
| InChI | InChI=1S/C19H19N5OS2/c1-13-14(2)27-18(26-13)16(12-20)17-21-22-19(23-8-10-25-11-9-23)24(17)15-6-4-3-5-7-15/h3-7H,8-11H2,1-2H3 |
| InChIKey | CMMQTVVASVUKLY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 66.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|