C27H21N5O4S — CID 2330731
2-(4-methoxyphenyl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]quinoline-4-carboxamide (PubChem CID 2330731) has the molecular formula C27H21N5O4S and a molecular weight of 511.56 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]quinoline-4-carboxamide.
| Compound Name | 2-(4-methoxyphenyl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 2330731 |
| Molecular Formula | C27H21N5O4S |
| Molecular Weight | 511.56 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]quinoline-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)Nc3ccc(S(=O)(=O)Nc4ncccn4)cc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C27H21N5O4S/c1-36-20-11-7-18(8-12-20)25-17-23(22-5-2-3-6-24(22)31-25)26(33)30-19-9-13-21(14-10-19)37(34,35)32-27-28-15-4-16-29-27/h2-17H,1H3,(H,30,33)(H,28,29,32) |
| InChIKey | KZUBDNGKPYBRMI-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 123.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |