About 1-(pyridin-4-ylmethyl)-3-(3,4,5-trimethoxyphenyl)urea
1-(pyridin-4-ylmethyl)-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 2330745) has the molecular formula C16H19N3O4
and a molecular weight of 317.35 g/mol. Its IUPAC name is 1-(pyridin-4-ylmethyl)-3-(3,4,5-trimethoxyphenyl)urea.
Molecular Properties
| Compound Name | 1-(pyridin-4-ylmethyl)-3-(3,4,5-trimethoxyphenyl)urea |
| PubChem CID | 2330745 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 1-(pyridin-4-ylmethyl)-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)NCc2ccncc2)cc(OC)c1OC |
| InChI | InChI=1S/C16H19N3O4/c1-21-13-8-12(9-14(22-2)15(13)23-3)19-16(20)18-10-11-4-6-17-7-5-11/h4-9H,10H2,1-3H3,(H2,18,19,20) |
| InChIKey | YKEPIQLKQQTMSV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(pyridin-4-ylmethyl)-3-(3,4,5-trimethoxyphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(pyridin-4-ylmethyl)-3-(3,4,5-trimethoxyphenyl)urea?
The IUPAC name of 1-(pyridin-4-ylmethyl)-3-(3,4,5-trimethoxyphenyl)urea (CID 2330745) is 1-(pyridin-4-ylmethyl)-3-(3,4,5-trimethoxyphenyl)urea.
What is the SMILES notation for 1-(pyridin-4-ylmethyl)-3-(3,4,5-trimethoxyphenyl)urea?
The canonical SMILES for 1-(pyridin-4-ylmethyl)-3-(3,4,5-trimethoxyphenyl)urea is COc1cc(NC(=O)NCc2ccncc2)cc(OC)c1OC.
What is the InChIKey of 1-(pyridin-4-ylmethyl)-3-(3,4,5-trimethoxyphenyl)urea?
The InChIKey is YKEPIQLKQQTMSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O4/c1-21-13-8-12(9-14(22-2)15(13)23-3)19-16(20)18-10-11-4-6-17-7-5-11/h4-9H,10H2,1-3H3,(H2,18,19,20).
What are the key properties of 1-(pyridin-4-ylmethyl)-3-(3,4,5-trimethoxyphenyl)urea?
1-(pyridin-4-ylmethyl)-3-(3,4,5-trimethoxyphenyl)urea has a molecular weight of 317.35 g/mol, XLogP of 2.43, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(pyridin-4-ylmethyl)-3-(3,4,5-trimethoxyphenyl)urea is sourced from PubChem (CID 2330745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).