About cobalt;bis(9-propan-2-ylfluoren-9-ide)
cobalt;bis(9-propan-2-ylfluoren-9-ide) (PubChem CID 23308202) has the molecular formula C32H30Co-2
and a molecular weight of 473.53 g/mol. Its IUPAC name is cobalt;bis(9-propan-2-ylfluoren-9-ide).
Molecular Properties
| Compound Name | cobalt;bis(9-propan-2-ylfluoren-9-ide) |
| PubChem CID | 23308202 |
| Molecular Formula | C32H30Co-2 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | cobalt;bis(9-propan-2-ylfluoren-9-ide) |
| SMILES | CC(C)[c-]1c2ccccc2c2ccccc21.CC(C)[c-]1c2ccccc2c2ccccc21.[Co] |
| InChI | InChI=1S/2C16H15.Co/c2*1-11(2)16-14-9-5-3-7-12(14)13-8-4-6-10-15(13)16;/h2*3-11H,1-2H3;/q2*-1; |
| InChIKey | RSROJGNJEDGBNK-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cobalt;bis(9-propan-2-ylfluoren-9-ide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;bis(9-propan-2-ylfluoren-9-ide)?
The IUPAC name of cobalt;bis(9-propan-2-ylfluoren-9-ide) (CID 23308202) is cobalt;bis(9-propan-2-ylfluoren-9-ide).
What is the SMILES notation for cobalt;bis(9-propan-2-ylfluoren-9-ide)?
The canonical SMILES for cobalt;bis(9-propan-2-ylfluoren-9-ide) is CC(C)[c-]1c2ccccc2c2ccccc21.CC(C)[c-]1c2ccccc2c2ccccc21.[Co].
What is the InChIKey of cobalt;bis(9-propan-2-ylfluoren-9-ide)?
The InChIKey is RSROJGNJEDGBNK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C16H15.Co/c2*1-11(2)16-14-9-5-3-7-12(14)13-8-4-6-10-15(13)16;/h2*3-11H,1-2H3;/q2*-1;.
What are the key properties of cobalt;bis(9-propan-2-ylfluoren-9-ide)?
cobalt;bis(9-propan-2-ylfluoren-9-ide) has a molecular weight of 473.53 g/mol, XLogP of 9.67, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;bis(9-propan-2-ylfluoren-9-ide) is sourced from PubChem (CID 23308202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).