C17H19F2NO2 — CID 23308451
[(Z)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2,6-difluorobenzoate (PubChem CID 23308451) has the molecular formula C17H19F2NO2 and a molecular weight of 307.34 g/mol. Its IUPAC name is [(Z)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2,6-difluorobenzoate.
| Compound Name | [(Z)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2,6-difluorobenzoate |
|---|---|
| PubChem CID | 23308451 |
| Molecular Formula | C17H19F2NO2 |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | [(Z)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2,6-difluorobenzoate |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)/C(=N\OC(=O)c1c(F)cccc1F)C2 |
| InChI | InChI=1S/C17H19F2NO2/c1-16(2)10-7-8-17(16,3)13(9-10)20-22-15(21)14-11(18)5-4-6-12(14)19/h4-6,10H,7-9H2,1-3H3/b20-13-/t10-,17-/m1/s1 |
| InChIKey | GNVQDKAWBVDRAP-HPSYWLFKSA-N |
| XLogP | 4.32 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|