C12H20N2O3 — CID 23308833
[(1S,4S,6Z)-6-hydroxyimino-1,3,3-trimethyl-2-azabicyclo[2.2.2]octan-2-yl] acetate (PubChem CID 23308833) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is [(1S,4S,6Z)-6-hydroxyimino-1,3,3-trimethyl-2-azabicyclo[2.2.2]octan-2-yl] acetate.
| Compound Name | [(1S,4S,6Z)-6-hydroxyimino-1,3,3-trimethyl-2-azabicyclo[2.2.2]octan-2-yl] acetate |
|---|---|
| PubChem CID | 23308833 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | [(1S,4S,6Z)-6-hydroxyimino-1,3,3-trimethyl-2-azabicyclo[2.2.2]octan-2-yl] acetate |
| SMILES | CC(=O)ON1C(C)(C)[C@H]2CC[C@@]1(C)/C(=N\O)C2 |
| InChI | InChI=1S/C12H20N2O3/c1-8(15)17-14-11(2,3)9-5-6-12(14,4)10(7-9)13-16/h9,16H,5-7H2,1-4H3/b13-10-/t9-,12-/m0/s1 |
| InChIKey | BSDUYRJFVXDWNM-ZDIZLJBNSA-N |
| XLogP | 1.95 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|