C13H15Cl3N3O5S+ — CID 23309106
[(3S)-1,1-dioxothiolan-3-yl]-[(1R)-2,2,2-trichloro-1-[(2-nitrobenzoyl)amino]ethyl]azanium (PubChem CID 23309106) has the molecular formula C13H15Cl3N3O5S+ and a molecular weight of 431.71 g/mol. Its IUPAC name is [(3S)-1,1-dioxothiolan-3-yl]-[(1R)-2,2,2-trichloro-1-[(2-nitrobenzoyl)amino]ethyl]azanium.
| Compound Name | [(3S)-1,1-dioxothiolan-3-yl]-[(1R)-2,2,2-trichloro-1-[(2-nitrobenzoyl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 23309106 |
| Molecular Formula | C13H15Cl3N3O5S+ |
| Molecular Weight | 431.71 g/mol |
| Exact Mass | 429.98 |
| IUPAC Name | [(3S)-1,1-dioxothiolan-3-yl]-[(1R)-2,2,2-trichloro-1-[(2-nitrobenzoyl)amino]ethyl]azanium |
| SMILES | O=C(N[C@H]([NH2+][C@H]1CCS(=O)(=O)C1)C(Cl)(Cl)Cl)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14Cl3N3O5S/c14-13(15,16)12(17-8-5-6-25(23,24)7-8)18-11(20)9-3-1-2-4-10(9)19(21)22/h1-4,8,12,17H,5-7H2,(H,18,20)/p+1/t8-,12-/m0/s1 |
| InChIKey | WEVYWFQDIWLBAB-UFBFGSQYSA-O |
| XLogP | 0.77 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.71 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|