C18H22ClNO — CID 23309675
(1S,3Z,4S)-3-[(2-chloro-5-methylanilino)methylidene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 23309675) has the molecular formula C18H22ClNO and a molecular weight of 303.83 g/mol. Its IUPAC name is (1S,3Z,4S)-3-[(2-chloro-5-methylanilino)methylidene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (1S,3Z,4S)-3-[(2-chloro-5-methylanilino)methylidene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 23309675 |
| Molecular Formula | C18H22ClNO |
| Molecular Weight | 303.83 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (1S,3Z,4S)-3-[(2-chloro-5-methylanilino)methylidene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | Cc1ccc(Cl)c(N/C=C2\C(=O)[C@@]3(C)CC[C@H]2C3(C)C)c1 |
| InChI | InChI=1S/C18H22ClNO/c1-11-5-6-14(19)15(9-11)20-10-12-13-7-8-18(4,16(12)21)17(13,2)3/h5-6,9-10,13,20H,7-8H2,1-4H3/b12-10-/t13-,18-/m1/s1 |
| InChIKey | HLXSUDISYCTUTM-SZHSMQGVSA-N |
| XLogP | 4.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.83 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|