C22H29N3OS — CID 23309846
(1S,4R)-N-[5-(4-ethoxyphenyl)-6-methyl-4H-1,3,4-thiadiazin-2-yl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine (PubChem CID 23309846) has the molecular formula C22H29N3OS and a molecular weight of 383.56 g/mol. Its IUPAC name is (1S,4R)-N-[5-(4-ethoxyphenyl)-6-methyl-4H-1,3,4-thiadiazin-2-yl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine.
| Compound Name | (1S,4R)-N-[5-(4-ethoxyphenyl)-6-methyl-4H-1,3,4-thiadiazin-2-yl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine |
|---|---|
| PubChem CID | 23309846 |
| Molecular Formula | C22H29N3OS |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | (1S,4R)-N-[5-(4-ethoxyphenyl)-6-methyl-4H-1,3,4-thiadiazin-2-yl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine |
| SMILES | CCOc1ccc(C2=C(C)SC(N=C3C[C@H]4CC[C@@]3(C)C4(C)C)=NN2)cc1 |
| InChI | InChI=1S/C22H29N3OS/c1-6-26-17-9-7-15(8-10-17)19-14(2)27-20(25-24-19)23-18-13-16-11-12-22(18,5)21(16,3)4/h7-10,16,24H,6,11-13H2,1-5H3/t16-,22-/m1/s1 |
| InChIKey | HYIYQGCFDSRWQM-OPAMFIHVSA-N |
| XLogP | 5.67 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|