C19H21ClN6OS — CID 23309965
4-[[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-[(2S)-oxolan-2-yl]-1H-1,2,4-triazole-5-thione (PubChem CID 23309965) has the molecular formula C19H21ClN6OS and a molecular weight of 416.94 g/mol. Its IUPAC name is 4-[[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-[(2S)-oxolan-2-yl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-[(2S)-oxolan-2-yl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 23309965 |
| Molecular Formula | C19H21ClN6OS |
| Molecular Weight | 416.94 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 4-[[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-[(2S)-oxolan-2-yl]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1ccc(C)c(-n2nc(C)c(C=Nn3c([C@@H]4CCCO4)n[nH]c3=S)c2Cl)c1 |
| InChI | InChI=1S/C19H21ClN6OS/c1-11-6-7-12(2)15(9-11)25-17(20)14(13(3)24-25)10-21-26-18(22-23-19(26)28)16-5-4-8-27-16/h6-7,9-10,16H,4-5,8H2,1-3H3,(H,23,28)/t16-/m0/s1 |
| InChIKey | CYFKDMLEBLATHW-INIZCTEOSA-N |
| XLogP | 4.44 |
| TPSA | 73.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.94 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|