About 6-bromo-1,3-dimethyl-2H-perimidine
6-bromo-1,3-dimethyl-2H-perimidine (PubChem CID 2331023) has the molecular formula C13H13BrN2
and a molecular weight of 277.16 g/mol. Its IUPAC name is 6-bromo-1,3-dimethyl-2H-perimidine.
Molecular Properties
| Compound Name | 6-bromo-1,3-dimethyl-2H-perimidine |
| PubChem CID | 2331023 |
| Molecular Formula | C13H13BrN2 |
| Molecular Weight | 277.16 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 6-bromo-1,3-dimethyl-2H-perimidine |
| SMILES | CN1CN(C)c2ccc(Br)c3cccc1c23 |
| InChI | InChI=1S/C13H13BrN2/c1-15-8-16(2)12-7-6-10(14)9-4-3-5-11(15)13(9)12/h3-7H,8H2,1-2H3 |
| InChIKey | XZUUEGKXOCXGJV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.16 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-1,3-dimethyl-2H-perimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1,3-dimethyl-2H-perimidine?
The IUPAC name of 6-bromo-1,3-dimethyl-2H-perimidine (CID 2331023) is 6-bromo-1,3-dimethyl-2H-perimidine.
What is the SMILES notation for 6-bromo-1,3-dimethyl-2H-perimidine?
The canonical SMILES for 6-bromo-1,3-dimethyl-2H-perimidine is CN1CN(C)c2ccc(Br)c3cccc1c23.
What is the InChIKey of 6-bromo-1,3-dimethyl-2H-perimidine?
The InChIKey is XZUUEGKXOCXGJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrN2/c1-15-8-16(2)12-7-6-10(14)9-4-3-5-11(15)13(9)12/h3-7H,8H2,1-2H3.
What are the key properties of 6-bromo-1,3-dimethyl-2H-perimidine?
6-bromo-1,3-dimethyl-2H-perimidine has a molecular weight of 277.16 g/mol, XLogP of 3.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1,3-dimethyl-2H-perimidine is sourced from PubChem (CID 2331023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).