About (E)-but-2-enedioic acid;1-(2-ethoxyethyl)-2-(piperazin-1-ylmethyl)benzimidazole;hydrate
(E)-but-2-enedioic acid;1-(2-ethoxyethyl)-2-(piperazin-1-ylmethyl)benzimidazole;hydrate (PubChem CID 23310590) has the molecular formula C20H30N4O6
and a molecular weight of 422.48 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-(2-ethoxyethyl)-2-(piperazin-1-ylmethyl)benzimidazole;hydrate.
Molecular Properties
| Compound Name | (E)-but-2-enedioic acid;1-(2-ethoxyethyl)-2-(piperazin-1-ylmethyl)benzimidazole;hydrate |
| PubChem CID | 23310590 |
| Molecular Formula | C20H30N4O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | (E)-but-2-enedioic acid;1-(2-ethoxyethyl)-2-(piperazin-1-ylmethyl)benzimidazole;hydrate |
| SMILES | CCOCCn1c(CN2CCNCC2)nc2ccccc21.O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C16H24N4O.C4H4O4.H2O/c1-2-21-12-11-20-15-6-4-3-5-14(15)18-16(20)13-19-9-7-17-8-10-19;5-3(6)1-2-4(7)8;/h3-6,17H,2,7-13H2,1H3;1-2H,(H,5,6)(H,7,8);1H2/b;2-1+; |
| InChIKey | IVOYADIFGVNQIE-JITBQSAISA-N |
| XLogP | 0.37 |
| TPSA | 148.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioic acid;1-(2-ethoxyethyl)-2-(piperazin-1-ylmethyl)benzimidazole;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioic acid;1-(2-ethoxyethyl)-2-(piperazin-1-ylmethyl)benzimidazole;hydrate?
The IUPAC name of (E)-but-2-enedioic acid;1-(2-ethoxyethyl)-2-(piperazin-1-ylmethyl)benzimidazole;hydrate (CID 23310590) is (E)-but-2-enedioic acid;1-(2-ethoxyethyl)-2-(piperazin-1-ylmethyl)benzimidazole;hydrate.
What is the SMILES notation for (E)-but-2-enedioic acid;1-(2-ethoxyethyl)-2-(piperazin-1-ylmethyl)benzimidazole;hydrate?
The canonical SMILES for (E)-but-2-enedioic acid;1-(2-ethoxyethyl)-2-(piperazin-1-ylmethyl)benzimidazole;hydrate is CCOCCn1c(CN2CCNCC2)nc2ccccc21.O.O=C(O)/C=C/C(=O)O.
What is the InChIKey of (E)-but-2-enedioic acid;1-(2-ethoxyethyl)-2-(piperazin-1-ylmethyl)benzimidazole;hydrate?
The InChIKey is IVOYADIFGVNQIE-JITBQSAISA-N. The full InChI is InChI=1S/C16H24N4O.C4H4O4.H2O/c1-2-21-12-11-20-15-6-4-3-5-14(15)18-16(20)13-19-9-7-17-8-10-19;5-3(6)1-2-4(7)8;/h3-6,17H,2,7-13H2,1H3;1-2H,(H,5,6)(H,7,8);1H2/b;2-1+;.
What are the key properties of (E)-but-2-enedioic acid;1-(2-ethoxyethyl)-2-(piperazin-1-ylmethyl)benzimidazole;hydrate?
(E)-but-2-enedioic acid;1-(2-ethoxyethyl)-2-(piperazin-1-ylmethyl)benzimidazole;hydrate has a molecular weight of 422.48 g/mol, XLogP of 0.37, 8 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioic acid;1-(2-ethoxyethyl)-2-(piperazin-1-ylmethyl)benzimidazole;hydrate is sourced from PubChem (CID 23310590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).