About [(4aR,8aR)-6-ethyl-3-(4-fluorophenyl)-4-oxo-4a,8a-dihydrochromen-7-yl] acetate
[(4aR,8aR)-6-ethyl-3-(4-fluorophenyl)-4-oxo-4a,8a-dihydrochromen-7-yl] acetate (PubChem CID 2331107) has the molecular formula C19H17FO4
and a molecular weight of 328.34 g/mol. Its IUPAC name is [(4aR,8aR)-6-ethyl-3-(4-fluorophenyl)-4-oxo-4a,8a-dihydrochromen-7-yl] acetate.
Molecular Properties
| Compound Name | [(4aR,8aR)-6-ethyl-3-(4-fluorophenyl)-4-oxo-4a,8a-dihydrochromen-7-yl] acetate |
| PubChem CID | 2331107 |
| Molecular Formula | C19H17FO4 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | [(4aR,8aR)-6-ethyl-3-(4-fluorophenyl)-4-oxo-4a,8a-dihydrochromen-7-yl] acetate |
| SMILES | CCC1=C[C@H]2C(=O)C(c3ccc(F)cc3)=CO[C@@H]2C=C1OC(C)=O |
| InChI | InChI=1S/C19H17FO4/c1-3-12-8-15-18(9-17(12)24-11(2)21)23-10-16(19(15)22)13-4-6-14(20)7-5-13/h4-10,15,18H,3H2,1-2H3/t15-,18-/m1/s1 |
| InChIKey | SJRYLEXDIJCGEO-CRAIPNDOSA-N |
| XLogP | 3.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(4aR,8aR)-6-ethyl-3-(4-fluorophenyl)-4-oxo-4a,8a-dihydrochromen-7-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4aR,8aR)-6-ethyl-3-(4-fluorophenyl)-4-oxo-4a,8a-dihydrochromen-7-yl] acetate?
The IUPAC name of [(4aR,8aR)-6-ethyl-3-(4-fluorophenyl)-4-oxo-4a,8a-dihydrochromen-7-yl] acetate (CID 2331107) is [(4aR,8aR)-6-ethyl-3-(4-fluorophenyl)-4-oxo-4a,8a-dihydrochromen-7-yl] acetate.
What is the SMILES notation for [(4aR,8aR)-6-ethyl-3-(4-fluorophenyl)-4-oxo-4a,8a-dihydrochromen-7-yl] acetate?
The canonical SMILES for [(4aR,8aR)-6-ethyl-3-(4-fluorophenyl)-4-oxo-4a,8a-dihydrochromen-7-yl] acetate is CCC1=C[C@H]2C(=O)C(c3ccc(F)cc3)=CO[C@@H]2C=C1OC(C)=O.
What is the InChIKey of [(4aR,8aR)-6-ethyl-3-(4-fluorophenyl)-4-oxo-4a,8a-dihydrochromen-7-yl] acetate?
The InChIKey is SJRYLEXDIJCGEO-CRAIPNDOSA-N. The full InChI is InChI=1S/C19H17FO4/c1-3-12-8-15-18(9-17(12)24-11(2)21)23-10-16(19(15)22)13-4-6-14(20)7-5-13/h4-10,15,18H,3H2,1-2H3/t15-,18-/m1/s1.
What are the key properties of [(4aR,8aR)-6-ethyl-3-(4-fluorophenyl)-4-oxo-4a,8a-dihydrochromen-7-yl] acetate?
[(4aR,8aR)-6-ethyl-3-(4-fluorophenyl)-4-oxo-4a,8a-dihydrochromen-7-yl] acetate has a molecular weight of 328.34 g/mol, XLogP of 3.55, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4aR,8aR)-6-ethyl-3-(4-fluorophenyl)-4-oxo-4a,8a-dihydrochromen-7-yl] acetate is sourced from PubChem (CID 2331107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).