C16H22N2O — CID 23311117
4-[bis(prop-2-enyl)amino]-7,8,9,10-tetrahydro-6H-pyrido[1,2-a]azepin-2-one (PubChem CID 23311117) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 4-[bis(prop-2-enyl)amino]-7,8,9,10-tetrahydro-6H-pyrido[1,2-a]azepin-2-one.
| Compound Name | 4-[bis(prop-2-enyl)amino]-7,8,9,10-tetrahydro-6H-pyrido[1,2-a]azepin-2-one |
|---|---|
| PubChem CID | 23311117 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 4-[bis(prop-2-enyl)amino]-7,8,9,10-tetrahydro-6H-pyrido[1,2-a]azepin-2-one |
| SMILES | C=CCN(CC=C)c1cc(=O)cc2n1CCCCC2 |
| InChI | InChI=1S/C16H22N2O/c1-3-9-17(10-4-2)16-13-15(19)12-14-8-6-5-7-11-18(14)16/h3-4,12-13H,1-2,5-11H2 |
| InChIKey | RHMYOZMHTRSZNT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|