About methyl 2-amino-3-oxopentanoate;hydrochloride
methyl 2-amino-3-oxopentanoate;hydrochloride (PubChem CID 23311259) has the molecular formula C6H12ClNO3
and a molecular weight of 181.62 g/mol. Its IUPAC name is methyl 2-amino-3-oxopentanoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 2-amino-3-oxopentanoate;hydrochloride |
| PubChem CID | 23311259 |
| Molecular Formula | C6H12ClNO3 |
| Molecular Weight | 181.62 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | methyl 2-amino-3-oxopentanoate;hydrochloride |
| SMILES | CCC(=O)C(N)C(=O)OC.Cl |
| InChI | InChI=1S/C6H11NO3.ClH/c1-3-4(8)5(7)6(9)10-2;/h5H,3,7H2,1-2H3;1H |
| InChIKey | YNMWSDZURABDTD-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.62 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-amino-3-oxopentanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-3-oxopentanoate;hydrochloride?
The IUPAC name of methyl 2-amino-3-oxopentanoate;hydrochloride (CID 23311259) is methyl 2-amino-3-oxopentanoate;hydrochloride.
What is the SMILES notation for methyl 2-amino-3-oxopentanoate;hydrochloride?
The canonical SMILES for methyl 2-amino-3-oxopentanoate;hydrochloride is CCC(=O)C(N)C(=O)OC.Cl.
What is the InChIKey of methyl 2-amino-3-oxopentanoate;hydrochloride?
The InChIKey is YNMWSDZURABDTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3.ClH/c1-3-4(8)5(7)6(9)10-2;/h5H,3,7H2,1-2H3;1H.
What are the key properties of methyl 2-amino-3-oxopentanoate;hydrochloride?
methyl 2-amino-3-oxopentanoate;hydrochloride has a molecular weight of 181.62 g/mol, XLogP of -0.11, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-3-oxopentanoate;hydrochloride is sourced from PubChem (CID 23311259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).