About 2-(ethylamino)propanenitrile;N-methoxyformamide
2-(ethylamino)propanenitrile;N-methoxyformamide (PubChem CID 23311295) has the molecular formula C7H15N3O2
and a molecular weight of 173.22 g/mol. Its IUPAC name is 2-(ethylamino)propanenitrile;N-methoxyformamide.
Molecular Properties
| Compound Name | 2-(ethylamino)propanenitrile;N-methoxyformamide |
| PubChem CID | 23311295 |
| Molecular Formula | C7H15N3O2 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2-(ethylamino)propanenitrile;N-methoxyformamide |
| SMILES | CCNC(C)C#N.CONC=O |
| InChI | InChI=1S/C5H10N2.C2H5NO2/c1-3-7-5(2)4-6;1-5-3-2-4/h5,7H,3H2,1-2H3;2H,1H3,(H,3,4) |
| InChIKey | VQEDHQONMMNBQU-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(ethylamino)propanenitrile;N-methoxyformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylamino)propanenitrile;N-methoxyformamide?
The IUPAC name of 2-(ethylamino)propanenitrile;N-methoxyformamide (CID 23311295) is 2-(ethylamino)propanenitrile;N-methoxyformamide.
What is the SMILES notation for 2-(ethylamino)propanenitrile;N-methoxyformamide?
The canonical SMILES for 2-(ethylamino)propanenitrile;N-methoxyformamide is CCNC(C)C#N.CONC=O.
What is the InChIKey of 2-(ethylamino)propanenitrile;N-methoxyformamide?
The InChIKey is VQEDHQONMMNBQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2.C2H5NO2/c1-3-7-5(2)4-6;1-5-3-2-4/h5,7H,3H2,1-2H3;2H,1H3,(H,3,4).
What are the key properties of 2-(ethylamino)propanenitrile;N-methoxyformamide?
2-(ethylamino)propanenitrile;N-methoxyformamide has a molecular weight of 173.22 g/mol, XLogP of -0.20, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylamino)propanenitrile;N-methoxyformamide is sourced from PubChem (CID 23311295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).