About 1-(1H-1,2,4-triazol-5-yl)propan-2-ol
1-(1H-1,2,4-triazol-5-yl)propan-2-ol (PubChem CID 23311302) has the molecular formula C5H9N3O
and a molecular weight of 127.15 g/mol. Its IUPAC name is 1-(1H-1,2,4-triazol-5-yl)propan-2-ol.
Molecular Properties
| Compound Name | 1-(1H-1,2,4-triazol-5-yl)propan-2-ol |
| PubChem CID | 23311302 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | 1-(1H-1,2,4-triazol-5-yl)propan-2-ol |
| SMILES | CC(O)Cc1ncn[nH]1 |
| InChI | InChI=1S/C5H9N3O/c1-4(9)2-5-6-3-7-8-5/h3-4,9H,2H2,1H3,(H,6,7,8) |
| InChIKey | KTAOQTYUCOXNFK-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1H-1,2,4-triazol-5-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-1,2,4-triazol-5-yl)propan-2-ol?
The IUPAC name of 1-(1H-1,2,4-triazol-5-yl)propan-2-ol (CID 23311302) is 1-(1H-1,2,4-triazol-5-yl)propan-2-ol.
What is the SMILES notation for 1-(1H-1,2,4-triazol-5-yl)propan-2-ol?
The canonical SMILES for 1-(1H-1,2,4-triazol-5-yl)propan-2-ol is CC(O)Cc1ncn[nH]1.
What is the InChIKey of 1-(1H-1,2,4-triazol-5-yl)propan-2-ol?
The InChIKey is KTAOQTYUCOXNFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O/c1-4(9)2-5-6-3-7-8-5/h3-4,9H,2H2,1H3,(H,6,7,8).
What are the key properties of 1-(1H-1,2,4-triazol-5-yl)propan-2-ol?
1-(1H-1,2,4-triazol-5-yl)propan-2-ol has a molecular weight of 127.15 g/mol, XLogP of -0.27, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-1,2,4-triazol-5-yl)propan-2-ol is sourced from PubChem (CID 23311302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).