About 3H-thioxanthene-2,9-dione
3H-thioxanthene-2,9-dione (PubChem CID 23311637) has the molecular formula C13H8O2S
and a molecular weight of 228.27 g/mol. Its IUPAC name is 3H-thioxanthene-2,9-dione.
Molecular Properties
| Compound Name | 3H-thioxanthene-2,9-dione |
| PubChem CID | 23311637 |
| Molecular Formula | C13H8O2S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 3H-thioxanthene-2,9-dione |
| SMILES | O=C1C=c2c(sc3ccccc3c2=O)=CC1 |
| InChI | InChI=1S/C13H8O2S/c14-8-5-6-12-10(7-8)13(15)9-3-1-2-4-11(9)16-12/h1-4,6-7H,5H2 |
| InChIKey | UVBAROQUSNNBCJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3H-thioxanthene-2,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-thioxanthene-2,9-dione?
The IUPAC name of 3H-thioxanthene-2,9-dione (CID 23311637) is 3H-thioxanthene-2,9-dione.
What is the SMILES notation for 3H-thioxanthene-2,9-dione?
The canonical SMILES for 3H-thioxanthene-2,9-dione is O=C1C=c2c(sc3ccccc3c2=O)=CC1.
What is the InChIKey of 3H-thioxanthene-2,9-dione?
The InChIKey is UVBAROQUSNNBCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O2S/c14-8-5-6-12-10(7-8)13(15)9-3-1-2-4-11(9)16-12/h1-4,6-7H,5H2.
What are the key properties of 3H-thioxanthene-2,9-dione?
3H-thioxanthene-2,9-dione has a molecular weight of 228.27 g/mol, XLogP of 0.80, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-thioxanthene-2,9-dione is sourced from PubChem (CID 23311637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).