C17H28OS2 — CID 23311682
3,5-bis(methylsulfanyl)-2,4,6-tripropylphenol (PubChem CID 23311682) has the molecular formula C17H28OS2 and a molecular weight of 312.54 g/mol. Its IUPAC name is 3,5-bis(methylsulfanyl)-2,4,6-tripropylphenol.
| Compound Name | 3,5-bis(methylsulfanyl)-2,4,6-tripropylphenol |
|---|---|
| PubChem CID | 23311682 |
| Molecular Formula | C17H28OS2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3,5-bis(methylsulfanyl)-2,4,6-tripropylphenol |
| SMILES | CCCc1c(O)c(CCC)c(SC)c(CCC)c1SC |
| InChI | InChI=1S/C17H28OS2/c1-6-9-12-15(18)13(10-7-2)17(20-5)14(11-8-3)16(12)19-4/h18H,6-11H2,1-5H3 |
| InChIKey | SRMUJIJJMKNMSF-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |