C17H29N — CID 23311884
2,6-dipropyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carbonitrile (PubChem CID 23311884) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is 2,6-dipropyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carbonitrile.
| Compound Name | 2,6-dipropyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carbonitrile |
|---|---|
| PubChem CID | 23311884 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 2,6-dipropyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carbonitrile |
| SMILES | CCCC1CCC2(C#N)CC(CCC)CCC2C1 |
| InChI | InChI=1S/C17H29N/c1-3-5-14-9-10-17(13-18)12-15(6-4-2)7-8-16(17)11-14/h14-16H,3-12H2,1-2H3 |
| InChIKey | BCPDWSPSCRYLEV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |