C10H16 — CID 23311940
5-ethyl-5,6-dimethylcyclohexa-1,3-diene (PubChem CID 23311940) has the molecular formula C10H16 and a molecular weight of 136.24 g/mol. Its IUPAC name is 5-ethyl-5,6-dimethylcyclohexa-1,3-diene.
| Compound Name | 5-ethyl-5,6-dimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 23311940 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | 5-ethyl-5,6-dimethylcyclohexa-1,3-diene |
| SMILES | CCC1(C)C=CC=CC1C |
| InChI | InChI=1S/C10H16/c1-4-10(3)8-6-5-7-9(10)2/h5-9H,4H2,1-3H3 |
| InChIKey | NCOIZTQVIXELOA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |