C14H16N2S — CID 2331222
3-benzyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-imine (PubChem CID 2331222) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is 3-benzyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-imine.
| Compound Name | 3-benzyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 2331222 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 3-benzyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-imine |
| SMILES | [H]/N=c1\sc2c(n1Cc1ccccc1)CCCC2 |
| InChI | InChI=1S/C14H16N2S/c15-14-16(10-11-6-2-1-3-7-11)12-8-4-5-9-13(12)17-14/h1-3,6-7,15H,4-5,8-10H2/b15-14- |
| InChIKey | TVVGMYAKARPYAQ-PFONDFGASA-N |
| XLogP | 2.96 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|