About 4-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-1-methyl-3,6-dihydro-2H-pyridine
4-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-1-methyl-3,6-dihydro-2H-pyridine (PubChem CID 23312287) has the molecular formula C17H19NO
and a molecular weight of 253.34 g/mol. Its IUPAC name is 4-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-1-methyl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 4-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-1-methyl-3,6-dihydro-2H-pyridine |
| PubChem CID | 23312287 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 4-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-1-methyl-3,6-dihydro-2H-pyridine |
| SMILES | CN1CC=C(c2cc3cc4c(cc3o2)CCC4)CC1 |
| InChI | InChI=1S/C17H19NO/c1-18-7-5-12(6-8-18)16-11-15-9-13-3-2-4-14(13)10-17(15)19-16/h5,9-11H,2-4,6-8H2,1H3 |
| InChIKey | UAILCXVHJWOEBM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-1-methyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-1-methyl-3,6-dihydro-2H-pyridine?
The IUPAC name of 4-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-1-methyl-3,6-dihydro-2H-pyridine (CID 23312287) is 4-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-1-methyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 4-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-1-methyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 4-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-1-methyl-3,6-dihydro-2H-pyridine is CN1CC=C(c2cc3cc4c(cc3o2)CCC4)CC1.
What is the InChIKey of 4-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-1-methyl-3,6-dihydro-2H-pyridine?
The InChIKey is UAILCXVHJWOEBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO/c1-18-7-5-12(6-8-18)16-11-15-9-13-3-2-4-14(13)10-17(15)19-16/h5,9-11H,2-4,6-8H2,1H3.
What are the key properties of 4-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-1-methyl-3,6-dihydro-2H-pyridine?
4-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-1-methyl-3,6-dihydro-2H-pyridine has a molecular weight of 253.34 g/mol, XLogP of 3.64, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-1-methyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 23312287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).