C15H27F6N — CID 23312485
N,N-bis(1,1-difluoropentyl)-1,1-difluoropentan-1-amine (PubChem CID 23312485) has the molecular formula C15H27F6N and a molecular weight of 335.38 g/mol. Its IUPAC name is N,N-bis(1,1-difluoropentyl)-1,1-difluoropentan-1-amine.
| Compound Name | N,N-bis(1,1-difluoropentyl)-1,1-difluoropentan-1-amine |
|---|---|
| PubChem CID | 23312485 |
| Molecular Formula | C15H27F6N |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | N,N-bis(1,1-difluoropentyl)-1,1-difluoropentan-1-amine |
| SMILES | CCCCC(F)(F)N(C(F)(F)CCCC)C(F)(F)CCCC |
| InChI | InChI=1S/C15H27F6N/c1-4-7-10-13(16,17)22(14(18,19)11-8-5-2)15(20,21)12-9-6-3/h4-12H2,1-3H3 |
| InChIKey | ZXPCCJZLKLHOMN-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|