About N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]methanimidamide;dihydrochloride
N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]methanimidamide;dihydrochloride (PubChem CID 23312556) has the molecular formula C9H15Cl2N5S
and a molecular weight of 296.23 g/mol. Its IUPAC name is N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]methanimidamide;dihydrochloride.
Molecular Properties
| Compound Name | N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]methanimidamide;dihydrochloride |
| PubChem CID | 23312556 |
| Molecular Formula | C9H15Cl2N5S |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]methanimidamide;dihydrochloride |
| SMILES | Cc1[nH]cnc1CSCC/N=C/NC#N.Cl.Cl |
| InChI | InChI=1S/C9H13N5S.2ClH/c1-8-9(14-7-13-8)4-15-3-2-11-6-12-5-10;;/h6-7H,2-4H2,1H3,(H,11,12)(H,13,14);2*1H |
| InChIKey | VPRNFTHJYYQVON-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]methanimidamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]methanimidamide;dihydrochloride?
The IUPAC name of N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]methanimidamide;dihydrochloride (CID 23312556) is N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]methanimidamide;dihydrochloride.
What is the SMILES notation for N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]methanimidamide;dihydrochloride?
The canonical SMILES for N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]methanimidamide;dihydrochloride is Cc1[nH]cnc1CSCC/N=C/NC#N.Cl.Cl.
What is the InChIKey of N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]methanimidamide;dihydrochloride?
The InChIKey is VPRNFTHJYYQVON-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5S.2ClH/c1-8-9(14-7-13-8)4-15-3-2-11-6-12-5-10;;/h6-7H,2-4H2,1H3,(H,11,12)(H,13,14);2*1H.
What are the key properties of N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]methanimidamide;dihydrochloride?
N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]methanimidamide;dihydrochloride has a molecular weight of 296.23 g/mol, XLogP of 1.89, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]methanimidamide;dihydrochloride is sourced from PubChem (CID 23312556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).