About phenol;chloride
phenol;chloride (PubChem CID 23313261) has the molecular formula C12H12ClO2-
and a molecular weight of 223.68 g/mol. Its IUPAC name is phenol;chloride.
Molecular Properties
| Compound Name | phenol;chloride |
| PubChem CID | 23313261 |
| Molecular Formula | C12H12ClO2- |
| Molecular Weight | 223.68 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | phenol;chloride |
| SMILES | Oc1ccccc1.Oc1ccccc1.[Cl-] |
| InChI | InChI=1S/2C6H6O.ClH/c2*7-6-4-2-1-3-5-6;/h2*1-5,7H;1H/p-1 |
| InChIKey | MMEXDJOSPVPDGS-UHFFFAOYSA-M |
| XLogP | -0.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.68 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phenol;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;chloride?
The IUPAC name of phenol;chloride (CID 23313261) is phenol;chloride.
What is the SMILES notation for phenol;chloride?
The canonical SMILES for phenol;chloride is Oc1ccccc1.Oc1ccccc1.[Cl-].
What is the InChIKey of phenol;chloride?
The InChIKey is MMEXDJOSPVPDGS-UHFFFAOYSA-M. The full InChI is InChI=1S/2C6H6O.ClH/c2*7-6-4-2-1-3-5-6;/h2*1-5,7H;1H/p-1.
What are the key properties of phenol;chloride?
phenol;chloride has a molecular weight of 223.68 g/mol, XLogP of -0.21, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;chloride is sourced from PubChem (CID 23313261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).