C13H14N2OS — CID 2331366
(2Z)-2-(thiophen-2-ylmethylidene)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-3-one (PubChem CID 2331366) has the molecular formula C13H14N2OS and a molecular weight of 246.33 g/mol. Its IUPAC name is (2Z)-2-(thiophen-2-ylmethylidene)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-3-one.
| Compound Name | (2Z)-2-(thiophen-2-ylmethylidene)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-3-one |
|---|---|
| PubChem CID | 2331366 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | (2Z)-2-(thiophen-2-ylmethylidene)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-3-one |
| SMILES | O=C1/C(=C/c2cccs2)N=C2CCCCCN12 |
| InChI | InChI=1S/C13H14N2OS/c16-13-11(9-10-5-4-8-17-10)14-12-6-2-1-3-7-15(12)13/h4-5,8-9H,1-3,6-7H2/b11-9- |
| InChIKey | PAPOWTPPVPBJOI-LUAWRHEFSA-N |
| XLogP | 2.90 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|