About 6-(pyridin-2-ylmethylsulfanyl)-5H-[1,3]dioxolo[4,5-f]benzimidazole;dihydrochloride
6-(pyridin-2-ylmethylsulfanyl)-5H-[1,3]dioxolo[4,5-f]benzimidazole;dihydrochloride (PubChem CID 23313798) has the molecular formula C14H13Cl2N3O2S
and a molecular weight of 358.25 g/mol. Its IUPAC name is 6-(pyridin-2-ylmethylsulfanyl)-5H-[1,3]dioxolo[4,5-f]benzimidazole;dihydrochloride.
Molecular Properties
| Compound Name | 6-(pyridin-2-ylmethylsulfanyl)-5H-[1,3]dioxolo[4,5-f]benzimidazole;dihydrochloride |
| PubChem CID | 23313798 |
| Molecular Formula | C14H13Cl2N3O2S |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 6-(pyridin-2-ylmethylsulfanyl)-5H-[1,3]dioxolo[4,5-f]benzimidazole;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(CSc2nc3cc4c(cc3[nH]2)OCO4)nc1 |
| InChI | InChI=1S/C14H11N3O2S.2ClH/c1-2-4-15-9(3-1)7-20-14-16-10-5-12-13(19-8-18-12)6-11(10)17-14;;/h1-6H,7-8H2,(H,16,17);2*1H |
| InChIKey | SWQHPJAUVILVQK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(pyridin-2-ylmethylsulfanyl)-5H-[1,3]dioxolo[4,5-f]benzimidazole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(pyridin-2-ylmethylsulfanyl)-5H-[1,3]dioxolo[4,5-f]benzimidazole;dihydrochloride?
The IUPAC name of 6-(pyridin-2-ylmethylsulfanyl)-5H-[1,3]dioxolo[4,5-f]benzimidazole;dihydrochloride (CID 23313798) is 6-(pyridin-2-ylmethylsulfanyl)-5H-[1,3]dioxolo[4,5-f]benzimidazole;dihydrochloride.
What is the SMILES notation for 6-(pyridin-2-ylmethylsulfanyl)-5H-[1,3]dioxolo[4,5-f]benzimidazole;dihydrochloride?
The canonical SMILES for 6-(pyridin-2-ylmethylsulfanyl)-5H-[1,3]dioxolo[4,5-f]benzimidazole;dihydrochloride is Cl.Cl.c1ccc(CSc2nc3cc4c(cc3[nH]2)OCO4)nc1.
What is the InChIKey of 6-(pyridin-2-ylmethylsulfanyl)-5H-[1,3]dioxolo[4,5-f]benzimidazole;dihydrochloride?
The InChIKey is SWQHPJAUVILVQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O2S.2ClH/c1-2-4-15-9(3-1)7-20-14-16-10-5-12-13(19-8-18-12)6-11(10)17-14;;/h1-6H,7-8H2,(H,16,17);2*1H.
What are the key properties of 6-(pyridin-2-ylmethylsulfanyl)-5H-[1,3]dioxolo[4,5-f]benzimidazole;dihydrochloride?
6-(pyridin-2-ylmethylsulfanyl)-5H-[1,3]dioxolo[4,5-f]benzimidazole;dihydrochloride has a molecular weight of 358.25 g/mol, XLogP of 3.82, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(pyridin-2-ylmethylsulfanyl)-5H-[1,3]dioxolo[4,5-f]benzimidazole;dihydrochloride is sourced from PubChem (CID 23313798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).