About 5-[1-[(4-fluoro-3-phenoxyphenyl)methoxy]-2-methylpropan-2-yl]-2,3-dihydro-1H-indene
5-[1-[(4-fluoro-3-phenoxyphenyl)methoxy]-2-methylpropan-2-yl]-2,3-dihydro-1H-indene (PubChem CID 23313956) has the molecular formula C26H27FO2
and a molecular weight of 390.50 g/mol. Its IUPAC name is 5-[1-[(4-fluoro-3-phenoxyphenyl)methoxy]-2-methylpropan-2-yl]-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 5-[1-[(4-fluoro-3-phenoxyphenyl)methoxy]-2-methylpropan-2-yl]-2,3-dihydro-1H-indene |
| PubChem CID | 23313956 |
| Molecular Formula | C26H27FO2 |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 5-[1-[(4-fluoro-3-phenoxyphenyl)methoxy]-2-methylpropan-2-yl]-2,3-dihydro-1H-indene |
| SMILES | CC(C)(COCc1ccc(F)c(Oc2ccccc2)c1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C26H27FO2/c1-26(2,22-13-12-20-7-6-8-21(20)16-22)18-28-17-19-11-14-24(27)25(15-19)29-23-9-4-3-5-10-23/h3-5,9-16H,6-8,17-18H2,1-2H3 |
| InChIKey | JWTPTCUWMMAROC-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[1-[(4-fluoro-3-phenoxyphenyl)methoxy]-2-methylpropan-2-yl]-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-[(4-fluoro-3-phenoxyphenyl)methoxy]-2-methylpropan-2-yl]-2,3-dihydro-1H-indene?
The IUPAC name of 5-[1-[(4-fluoro-3-phenoxyphenyl)methoxy]-2-methylpropan-2-yl]-2,3-dihydro-1H-indene (CID 23313956) is 5-[1-[(4-fluoro-3-phenoxyphenyl)methoxy]-2-methylpropan-2-yl]-2,3-dihydro-1H-indene.
What is the SMILES notation for 5-[1-[(4-fluoro-3-phenoxyphenyl)methoxy]-2-methylpropan-2-yl]-2,3-dihydro-1H-indene?
The canonical SMILES for 5-[1-[(4-fluoro-3-phenoxyphenyl)methoxy]-2-methylpropan-2-yl]-2,3-dihydro-1H-indene is CC(C)(COCc1ccc(F)c(Oc2ccccc2)c1)c1ccc2c(c1)CCC2.
What is the InChIKey of 5-[1-[(4-fluoro-3-phenoxyphenyl)methoxy]-2-methylpropan-2-yl]-2,3-dihydro-1H-indene?
The InChIKey is JWTPTCUWMMAROC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27FO2/c1-26(2,22-13-12-20-7-6-8-21(20)16-22)18-28-17-19-11-14-24(27)25(15-19)29-23-9-4-3-5-10-23/h3-5,9-16H,6-8,17-18H2,1-2H3.
What are the key properties of 5-[1-[(4-fluoro-3-phenoxyphenyl)methoxy]-2-methylpropan-2-yl]-2,3-dihydro-1H-indene?
5-[1-[(4-fluoro-3-phenoxyphenyl)methoxy]-2-methylpropan-2-yl]-2,3-dihydro-1H-indene has a molecular weight of 390.50 g/mol, XLogP of 6.60, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-[(4-fluoro-3-phenoxyphenyl)methoxy]-2-methylpropan-2-yl]-2,3-dihydro-1H-indene is sourced from PubChem (CID 23313956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).