About 6-N,6-N-dimethylphenanthridine-3,6,8-triamine
6-N,6-N-dimethylphenanthridine-3,6,8-triamine (PubChem CID 23314008) has the molecular formula C15H16N4
and a molecular weight of 252.32 g/mol. Its IUPAC name is 6-N,6-N-dimethylphenanthridine-3,6,8-triamine.
Molecular Properties
| Compound Name | 6-N,6-N-dimethylphenanthridine-3,6,8-triamine |
| PubChem CID | 23314008 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 6-N,6-N-dimethylphenanthridine-3,6,8-triamine |
| SMILES | CN(C)c1nc2cc(N)ccc2c2ccc(N)cc12 |
| InChI | InChI=1S/C15H16N4/c1-19(2)15-13-7-9(16)3-5-11(13)12-6-4-10(17)8-14(12)18-15/h3-8H,16-17H2,1-2H3 |
| InChIKey | MVEGBSMMTJJPDN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 6-N,6-N-dimethylphenanthridine-3,6,8-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N,6-N-dimethylphenanthridine-3,6,8-triamine?
The IUPAC name of 6-N,6-N-dimethylphenanthridine-3,6,8-triamine (CID 23314008) is 6-N,6-N-dimethylphenanthridine-3,6,8-triamine.
What is the SMILES notation for 6-N,6-N-dimethylphenanthridine-3,6,8-triamine?
The canonical SMILES for 6-N,6-N-dimethylphenanthridine-3,6,8-triamine is CN(C)c1nc2cc(N)ccc2c2ccc(N)cc12.
What is the InChIKey of 6-N,6-N-dimethylphenanthridine-3,6,8-triamine?
The InChIKey is MVEGBSMMTJJPDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4/c1-19(2)15-13-7-9(16)3-5-11(13)12-6-4-10(17)8-14(12)18-15/h3-8H,16-17H2,1-2H3.
What are the key properties of 6-N,6-N-dimethylphenanthridine-3,6,8-triamine?
6-N,6-N-dimethylphenanthridine-3,6,8-triamine has a molecular weight of 252.32 g/mol, XLogP of 2.62, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N,6-N-dimethylphenanthridine-3,6,8-triamine is sourced from PubChem (CID 23314008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).