About 1,4-diiodotriazole
1,4-diiodotriazole (PubChem CID 23314143) has the molecular formula C2HI2N3
and a molecular weight of 320.86 g/mol. Its IUPAC name is 1,4-diiodotriazole.
Molecular Properties
| Compound Name | 1,4-diiodotriazole |
| PubChem CID | 23314143 |
| Molecular Formula | C2HI2N3 |
| Molecular Weight | 320.86 g/mol |
| Exact Mass | 320.83 |
| IUPAC Name | 1,4-diiodotriazole |
| SMILES | Ic1cn(I)nn1 |
| InChI | InChI=1S/C2HI2N3/c3-2-1-7(4)6-5-2/h1H |
| InChIKey | LAPFSSMHDRDDJF-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.86 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,4-diiodotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diiodotriazole?
The IUPAC name of 1,4-diiodotriazole (CID 23314143) is 1,4-diiodotriazole.
What is the SMILES notation for 1,4-diiodotriazole?
The canonical SMILES for 1,4-diiodotriazole is Ic1cn(I)nn1.
What is the InChIKey of 1,4-diiodotriazole?
The InChIKey is LAPFSSMHDRDDJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2HI2N3/c3-2-1-7(4)6-5-2/h1H.
What are the key properties of 1,4-diiodotriazole?
1,4-diiodotriazole has a molecular weight of 320.86 g/mol, XLogP of 1.08, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diiodotriazole is sourced from PubChem (CID 23314143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).