About 1-[2-(4-fluorophenyl)-4-(4-methylphenyl)butyl]-1,2,4-triazole;hydrochloride
1-[2-(4-fluorophenyl)-4-(4-methylphenyl)butyl]-1,2,4-triazole;hydrochloride (PubChem CID 23315452) has the molecular formula C19H21ClFN3
and a molecular weight of 345.85 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-4-(4-methylphenyl)butyl]-1,2,4-triazole;hydrochloride.
Molecular Properties
| Compound Name | 1-[2-(4-fluorophenyl)-4-(4-methylphenyl)butyl]-1,2,4-triazole;hydrochloride |
| PubChem CID | 23315452 |
| Molecular Formula | C19H21ClFN3 |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-4-(4-methylphenyl)butyl]-1,2,4-triazole;hydrochloride |
| SMILES | Cc1ccc(CCC(Cn2cncn2)c2ccc(F)cc2)cc1.Cl |
| InChI | InChI=1S/C19H20FN3.ClH/c1-15-2-4-16(5-3-15)6-7-18(12-23-14-21-13-22-23)17-8-10-19(20)11-9-17;/h2-5,8-11,13-14,18H,6-7,12H2,1H3;1H |
| InChIKey | WUIOUGHBTDDZRQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(4-fluorophenyl)-4-(4-methylphenyl)butyl]-1,2,4-triazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4-fluorophenyl)-4-(4-methylphenyl)butyl]-1,2,4-triazole;hydrochloride?
The IUPAC name of 1-[2-(4-fluorophenyl)-4-(4-methylphenyl)butyl]-1,2,4-triazole;hydrochloride (CID 23315452) is 1-[2-(4-fluorophenyl)-4-(4-methylphenyl)butyl]-1,2,4-triazole;hydrochloride.
What is the SMILES notation for 1-[2-(4-fluorophenyl)-4-(4-methylphenyl)butyl]-1,2,4-triazole;hydrochloride?
The canonical SMILES for 1-[2-(4-fluorophenyl)-4-(4-methylphenyl)butyl]-1,2,4-triazole;hydrochloride is Cc1ccc(CCC(Cn2cncn2)c2ccc(F)cc2)cc1.Cl.
What is the InChIKey of 1-[2-(4-fluorophenyl)-4-(4-methylphenyl)butyl]-1,2,4-triazole;hydrochloride?
The InChIKey is WUIOUGHBTDDZRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20FN3.ClH/c1-15-2-4-16(5-3-15)6-7-18(12-23-14-21-13-22-23)17-8-10-19(20)11-9-17;/h2-5,8-11,13-14,18H,6-7,12H2,1H3;1H.
What are the key properties of 1-[2-(4-fluorophenyl)-4-(4-methylphenyl)butyl]-1,2,4-triazole;hydrochloride?
1-[2-(4-fluorophenyl)-4-(4-methylphenyl)butyl]-1,2,4-triazole;hydrochloride has a molecular weight of 345.85 g/mol, XLogP of 4.56, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4-fluorophenyl)-4-(4-methylphenyl)butyl]-1,2,4-triazole;hydrochloride is sourced from PubChem (CID 23315452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).