C21H26Cl2N2O3 — CID 23315588
[4-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-3-(2,5-dihydropyrrol-1-yl)cyclohexyl] acetate (PubChem CID 23315588) has the molecular formula C21H26Cl2N2O3 and a molecular weight of 425.36 g/mol. Its IUPAC name is [4-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-3-(2,5-dihydropyrrol-1-yl)cyclohexyl] acetate.
| Compound Name | [4-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-3-(2,5-dihydropyrrol-1-yl)cyclohexyl] acetate |
|---|---|
| PubChem CID | 23315588 |
| Molecular Formula | C21H26Cl2N2O3 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | [4-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-3-(2,5-dihydropyrrol-1-yl)cyclohexyl] acetate |
| SMILES | CC(=O)OC1CCC(N(C)C(=O)Cc2ccc(Cl)c(Cl)c2)C(N2CC=CC2)C1 |
| InChI | InChI=1S/C21H26Cl2N2O3/c1-14(26)28-16-6-8-19(20(13-16)25-9-3-4-10-25)24(2)21(27)12-15-5-7-17(22)18(23)11-15/h3-5,7,11,16,19-20H,6,8-10,12-13H2,1-2H3 |
| InChIKey | HEAZEURUQHIDSX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|