C22H28Cl2N2O3 — CID 23315593
2-(3,4-dichlorophenyl)-N-[9-(2,5-dihydropyrrol-1-yl)-1,4-dioxaspiro[4.6]undecan-8-yl]-N-methylacetamide (PubChem CID 23315593) has the molecular formula C22H28Cl2N2O3 and a molecular weight of 439.38 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[9-(2,5-dihydropyrrol-1-yl)-1,4-dioxaspiro[4.6]undecan-8-yl]-N-methylacetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-[9-(2,5-dihydropyrrol-1-yl)-1,4-dioxaspiro[4.6]undecan-8-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 23315593 |
| Molecular Formula | C22H28Cl2N2O3 |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[9-(2,5-dihydropyrrol-1-yl)-1,4-dioxaspiro[4.6]undecan-8-yl]-N-methylacetamide |
| SMILES | CN(C(=O)Cc1ccc(Cl)c(Cl)c1)C1CCC2(CCC1N1CC=CC1)OCCO2 |
| InChI | InChI=1S/C22H28Cl2N2O3/c1-25(21(27)15-16-4-5-17(23)18(24)14-16)19-6-8-22(28-12-13-29-22)9-7-20(19)26-10-2-3-11-26/h2-5,14,19-20H,6-13,15H2,1H3 |
| InChIKey | KOTXYRAWFMZXJU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|