About tris(diethylamino)sulfanium;fluoride;hydrofluoride
tris(diethylamino)sulfanium;fluoride;hydrofluoride (PubChem CID 23315809) has the molecular formula C12H31F2N3S
and a molecular weight of 287.46 g/mol. Its IUPAC name is tris(diethylamino)sulfanium;fluoride;hydrofluoride.
Molecular Properties
| Compound Name | tris(diethylamino)sulfanium;fluoride;hydrofluoride |
| PubChem CID | 23315809 |
| Molecular Formula | C12H31F2N3S |
| Molecular Weight | 287.46 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | tris(diethylamino)sulfanium;fluoride;hydrofluoride |
| SMILES | CCN(CC)[S+](N(CC)CC)N(CC)CC.F.[F-] |
| InChI | InChI=1S/C12H30N3S.2FH/c1-7-13(8-2)16(14(9-3)10-4)15(11-5)12-6;;/h7-12H2,1-6H3;2*1H/q+1;;/p-1 |
| InChIKey | FPCAUMSVZWJBFQ-UHFFFAOYSA-M |
| XLogP | -0.47 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.46 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze tris(diethylamino)sulfanium;fluoride;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(diethylamino)sulfanium;fluoride;hydrofluoride?
The IUPAC name of tris(diethylamino)sulfanium;fluoride;hydrofluoride (CID 23315809) is tris(diethylamino)sulfanium;fluoride;hydrofluoride.
What is the SMILES notation for tris(diethylamino)sulfanium;fluoride;hydrofluoride?
The canonical SMILES for tris(diethylamino)sulfanium;fluoride;hydrofluoride is CCN(CC)[S+](N(CC)CC)N(CC)CC.F.[F-].
What is the InChIKey of tris(diethylamino)sulfanium;fluoride;hydrofluoride?
The InChIKey is FPCAUMSVZWJBFQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H30N3S.2FH/c1-7-13(8-2)16(14(9-3)10-4)15(11-5)12-6;;/h7-12H2,1-6H3;2*1H/q+1;;/p-1.
What are the key properties of tris(diethylamino)sulfanium;fluoride;hydrofluoride?
tris(diethylamino)sulfanium;fluoride;hydrofluoride has a molecular weight of 287.46 g/mol, XLogP of -0.47, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tris(diethylamino)sulfanium;fluoride;hydrofluoride is sourced from PubChem (CID 23315809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).