C17H21N5S — CID 2331594
1-prop-2-enyl-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiourea (PubChem CID 2331594) has the molecular formula C17H21N5S and a molecular weight of 327.46 g/mol. Its IUPAC name is 1-prop-2-enyl-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiourea.
| Compound Name | 1-prop-2-enyl-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 2331594 |
| Molecular Formula | C17H21N5S |
| Molecular Weight | 327.46 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 1-prop-2-enyl-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]thiourea |
| SMILES | C=CCNC(=S)Nc1ccccc1-c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C17H21N5S/c1-2-11-18-17(23)19-14-9-6-5-8-13(14)16-21-20-15-10-4-3-7-12-22(15)16/h2,5-6,8-9H,1,3-4,7,10-12H2,(H2,18,19,23) |
| InChIKey | YOECYKSJAHSERQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|