C24H17ClN2O3S — CID 23316275
1-amino-4-(4-chlorophenyl)sulfanyl-2-(5,6-dihydro-4H-1,3-oxazin-2-yl)anthracene-9,10-dione (PubChem CID 23316275) has the molecular formula C24H17ClN2O3S and a molecular weight of 448.93 g/mol. Its IUPAC name is 1-amino-4-(4-chlorophenyl)sulfanyl-2-(5,6-dihydro-4H-1,3-oxazin-2-yl)anthracene-9,10-dione.
| Compound Name | 1-amino-4-(4-chlorophenyl)sulfanyl-2-(5,6-dihydro-4H-1,3-oxazin-2-yl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 23316275 |
| Molecular Formula | C24H17ClN2O3S |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 1-amino-4-(4-chlorophenyl)sulfanyl-2-(5,6-dihydro-4H-1,3-oxazin-2-yl)anthracene-9,10-dione |
| SMILES | Nc1c(C2=NCCCO2)cc(Sc2ccc(Cl)cc2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H17ClN2O3S/c25-13-6-8-14(9-7-13)31-18-12-17(24-27-10-3-11-30-24)21(26)20-19(18)22(28)15-4-1-2-5-16(15)23(20)29/h1-2,4-9,12H,3,10-11,26H2 |
| InChIKey | IEXMYRKJFRWRDB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|