About (2Z,6E)-4-methyl-2,6-bis[[4-(trifluoromethyl)phenyl]methylidene]cyclohexan-1-one
(2Z,6E)-4-methyl-2,6-bis[[4-(trifluoromethyl)phenyl]methylidene]cyclohexan-1-one (PubChem CID 2331629) has the molecular formula C23H18F6O
and a molecular weight of 424.38 g/mol. Its IUPAC name is (2Z,6E)-4-methyl-2,6-bis[[4-(trifluoromethyl)phenyl]methylidene]cyclohexan-1-one.
Molecular Properties
| Compound Name | (2Z,6E)-4-methyl-2,6-bis[[4-(trifluoromethyl)phenyl]methylidene]cyclohexan-1-one |
| PubChem CID | 2331629 |
| Molecular Formula | C23H18F6O |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | (2Z,6E)-4-methyl-2,6-bis[[4-(trifluoromethyl)phenyl]methylidene]cyclohexan-1-one |
| SMILES | CC1C/C(=C/c2ccc(C(F)(F)F)cc2)C(=O)/C(=C/c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C23H18F6O/c1-14-10-17(12-15-2-6-19(7-3-15)22(24,25)26)21(30)18(11-14)13-16-4-8-20(9-5-16)23(27,28)29/h2-9,12-14H,10-11H2,1H3/b17-12-,18-13+ |
| InChIKey | CHWYPPRBAWCRMC-BQWARBPISA-N |
| XLogP | 7.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z,6E)-4-methyl-2,6-bis[[4-(trifluoromethyl)phenyl]methylidene]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,6E)-4-methyl-2,6-bis[[4-(trifluoromethyl)phenyl]methylidene]cyclohexan-1-one?
The IUPAC name of (2Z,6E)-4-methyl-2,6-bis[[4-(trifluoromethyl)phenyl]methylidene]cyclohexan-1-one (CID 2331629) is (2Z,6E)-4-methyl-2,6-bis[[4-(trifluoromethyl)phenyl]methylidene]cyclohexan-1-one.
What is the SMILES notation for (2Z,6E)-4-methyl-2,6-bis[[4-(trifluoromethyl)phenyl]methylidene]cyclohexan-1-one?
The canonical SMILES for (2Z,6E)-4-methyl-2,6-bis[[4-(trifluoromethyl)phenyl]methylidene]cyclohexan-1-one is CC1C/C(=C/c2ccc(C(F)(F)F)cc2)C(=O)/C(=C/c2ccc(C(F)(F)F)cc2)C1.
What is the InChIKey of (2Z,6E)-4-methyl-2,6-bis[[4-(trifluoromethyl)phenyl]methylidene]cyclohexan-1-one?
The InChIKey is CHWYPPRBAWCRMC-BQWARBPISA-N. The full InChI is InChI=1S/C23H18F6O/c1-14-10-17(12-15-2-6-19(7-3-15)22(24,25)26)21(30)18(11-14)13-16-4-8-20(9-5-16)23(27,28)29/h2-9,12-14H,10-11H2,1H3/b17-12-,18-13+.
What are the key properties of (2Z,6E)-4-methyl-2,6-bis[[4-(trifluoromethyl)phenyl]methylidene]cyclohexan-1-one?
(2Z,6E)-4-methyl-2,6-bis[[4-(trifluoromethyl)phenyl]methylidene]cyclohexan-1-one has a molecular weight of 424.38 g/mol, XLogP of 7.19, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,6E)-4-methyl-2,6-bis[[4-(trifluoromethyl)phenyl]methylidene]cyclohexan-1-one is sourced from PubChem (CID 2331629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).