C12H20N2O2 — CID 23316326
2-methoxy-4-N-(1-methoxybutan-2-yl)benzene-1,4-diamine (PubChem CID 23316326) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-methoxy-4-N-(1-methoxybutan-2-yl)benzene-1,4-diamine.
| Compound Name | 2-methoxy-4-N-(1-methoxybutan-2-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 23316326 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2-methoxy-4-N-(1-methoxybutan-2-yl)benzene-1,4-diamine |
| SMILES | CCC(COC)Nc1ccc(N)c(OC)c1 |
| InChI | InChI=1S/C12H20N2O2/c1-4-9(8-15-2)14-10-5-6-11(13)12(7-10)16-3/h5-7,9,14H,4,8,13H2,1-3H3 |
| InChIKey | FUNOPMUGSNCNQO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|