C16H13ClF3NO2 — CID 23316713
2-[2-chloro-5-(trifluoromethyl)phenyl]-5-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23316713) has the molecular formula C16H13ClF3NO2 and a molecular weight of 343.73 g/mol. Its IUPAC name is 2-[2-chloro-5-(trifluoromethyl)phenyl]-5-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[2-chloro-5-(trifluoromethyl)phenyl]-5-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23316713 |
| Molecular Formula | C16H13ClF3NO2 |
| Molecular Weight | 343.73 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 2-[2-chloro-5-(trifluoromethyl)phenyl]-5-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC1=CCC2C(=O)N(c3cc(C(F)(F)F)ccc3Cl)C(=O)C2C1 |
| InChI | InChI=1S/C16H13ClF3NO2/c1-8-2-4-10-11(6-8)15(23)21(14(10)22)13-7-9(16(18,19)20)3-5-12(13)17/h2-3,5,7,10-11H,4,6H2,1H3 |
| InChIKey | FVXGCKJJMFOEGY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.73 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|