C20H26N3O4S+ — CID 2331691
3-[methyl(phenyl)sulfamoyl]-N-(2-morpholin-4-ium-4-ylethyl)benzamide (PubChem CID 2331691) has the molecular formula C20H26N3O4S+ and a molecular weight of 404.51 g/mol. Its IUPAC name is 3-[methyl(phenyl)sulfamoyl]-N-(2-morpholin-4-ium-4-ylethyl)benzamide.
| Compound Name | 3-[methyl(phenyl)sulfamoyl]-N-(2-morpholin-4-ium-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 2331691 |
| Molecular Formula | C20H26N3O4S+ |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 3-[methyl(phenyl)sulfamoyl]-N-(2-morpholin-4-ium-4-ylethyl)benzamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)NCC[NH+]2CCOCC2)c1 |
| InChI | InChI=1S/C20H25N3O4S/c1-22(18-7-3-2-4-8-18)28(25,26)19-9-5-6-17(16-19)20(24)21-10-11-23-12-14-27-15-13-23/h2-9,16H,10-15H2,1H3,(H,21,24)/p+1 |
| InChIKey | YAQOVUUXDVGNON-UHFFFAOYSA-O |
| XLogP | 0.16 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |