C8H9Cl3N2 — CID 23317101
N'-(2,4,5-trichlorophenyl)ethane-1,2-diamine (PubChem CID 23317101) has the molecular formula C8H9Cl3N2 and a molecular weight of 239.53 g/mol. Its IUPAC name is N'-(2,4,5-trichlorophenyl)ethane-1,2-diamine.
| Compound Name | N'-(2,4,5-trichlorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 23317101 |
| Molecular Formula | C8H9Cl3N2 |
| Molecular Weight | 239.53 g/mol |
| Exact Mass | 237.98 |
| IUPAC Name | N'-(2,4,5-trichlorophenyl)ethane-1,2-diamine |
| SMILES | NCCNc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C8H9Cl3N2/c9-5-3-7(11)8(4-6(5)10)13-2-1-12/h3-4,13H,1-2,12H2 |
| InChIKey | WXDHAHLMKMIXAY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|