C19H23ClN2O4 — CID 23317216
N-[3-(4-chloro-N-methylanilino)-2-hydroxypropyl]-3,4-dimethoxybenzamide (PubChem CID 23317216) has the molecular formula C19H23ClN2O4 and a molecular weight of 378.86 g/mol. Its IUPAC name is N-[3-(4-chloro-N-methylanilino)-2-hydroxypropyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[3-(4-chloro-N-methylanilino)-2-hydroxypropyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 23317216 |
| Molecular Formula | C19H23ClN2O4 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | N-[3-(4-chloro-N-methylanilino)-2-hydroxypropyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC(O)CN(C)c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C19H23ClN2O4/c1-22(15-7-5-14(20)6-8-15)12-16(23)11-21-19(24)13-4-9-17(25-2)18(10-13)26-3/h4-10,16,23H,11-12H2,1-3H3,(H,21,24) |
| InChIKey | WDQPJQINHTXUTN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |