C21H20N2O7S — CID 23317239
[2-(2-hydroxyethyl)-4-oxo-3-(2-oxo-4,5-diphenyl-1,3-oxazol-3-yl)azetidin-1-yl]methanesulfonic acid (PubChem CID 23317239) has the molecular formula C21H20N2O7S and a molecular weight of 444.47 g/mol. Its IUPAC name is [2-(2-hydroxyethyl)-4-oxo-3-(2-oxo-4,5-diphenyl-1,3-oxazol-3-yl)azetidin-1-yl]methanesulfonic acid.
| Compound Name | [2-(2-hydroxyethyl)-4-oxo-3-(2-oxo-4,5-diphenyl-1,3-oxazol-3-yl)azetidin-1-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 23317239 |
| Molecular Formula | C21H20N2O7S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | [2-(2-hydroxyethyl)-4-oxo-3-(2-oxo-4,5-diphenyl-1,3-oxazol-3-yl)azetidin-1-yl]methanesulfonic acid |
| SMILES | O=C1C(n2c(-c3ccccc3)c(-c3ccccc3)oc2=O)C(CCO)N1CS(=O)(=O)O |
| InChI | InChI=1S/C21H20N2O7S/c24-12-11-16-18(20(25)22(16)13-31(27,28)29)23-17(14-7-3-1-4-8-14)19(30-21(23)26)15-9-5-2-6-10-15/h1-10,16,18,24H,11-13H2,(H,27,28,29) |
| InChIKey | CRDZXGQIOGMBBY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|