About 2-(2-hydroxyphenyl)-4-methyl-4H-1,2-benzothiazin-3-one
2-(2-hydroxyphenyl)-4-methyl-4H-1,2-benzothiazin-3-one (PubChem CID 23317443) has the molecular formula C15H13NO2S
and a molecular weight of 271.34 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-4-methyl-4H-1,2-benzothiazin-3-one.
Molecular Properties
| Compound Name | 2-(2-hydroxyphenyl)-4-methyl-4H-1,2-benzothiazin-3-one |
| PubChem CID | 23317443 |
| Molecular Formula | C15H13NO2S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 2-(2-hydroxyphenyl)-4-methyl-4H-1,2-benzothiazin-3-one |
| SMILES | CC1C(=O)N(c2ccccc2O)Sc2ccccc21 |
| InChI | InChI=1S/C15H13NO2S/c1-10-11-6-2-5-9-14(11)19-16(15(10)18)12-7-3-4-8-13(12)17/h2-10,17H,1H3 |
| InChIKey | LNXZICFQLZFNCD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyphenyl)-4-methyl-4H-1,2-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyphenyl)-4-methyl-4H-1,2-benzothiazin-3-one?
The IUPAC name of 2-(2-hydroxyphenyl)-4-methyl-4H-1,2-benzothiazin-3-one (CID 23317443) is 2-(2-hydroxyphenyl)-4-methyl-4H-1,2-benzothiazin-3-one.
What is the SMILES notation for 2-(2-hydroxyphenyl)-4-methyl-4H-1,2-benzothiazin-3-one?
The canonical SMILES for 2-(2-hydroxyphenyl)-4-methyl-4H-1,2-benzothiazin-3-one is CC1C(=O)N(c2ccccc2O)Sc2ccccc21.
What is the InChIKey of 2-(2-hydroxyphenyl)-4-methyl-4H-1,2-benzothiazin-3-one?
The InChIKey is LNXZICFQLZFNCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO2S/c1-10-11-6-2-5-9-14(11)19-16(15(10)18)12-7-3-4-8-13(12)17/h2-10,17H,1H3.
What are the key properties of 2-(2-hydroxyphenyl)-4-methyl-4H-1,2-benzothiazin-3-one?
2-(2-hydroxyphenyl)-4-methyl-4H-1,2-benzothiazin-3-one has a molecular weight of 271.34 g/mol, XLogP of 3.55, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyphenyl)-4-methyl-4H-1,2-benzothiazin-3-one is sourced from PubChem (CID 23317443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).