About 4-(1,2,2-trimorpholin-4-ylethenyl)morpholine
4-(1,2,2-trimorpholin-4-ylethenyl)morpholine (PubChem CID 23317607) has the molecular formula C18H32N4O4
and a molecular weight of 368.48 g/mol. Its IUPAC name is 4-(1,2,2-trimorpholin-4-ylethenyl)morpholine.
Molecular Properties
| Compound Name | 4-(1,2,2-trimorpholin-4-ylethenyl)morpholine |
| PubChem CID | 23317607 |
| Molecular Formula | C18H32N4O4 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 4-(1,2,2-trimorpholin-4-ylethenyl)morpholine |
| SMILES | C1CN(C(=C(N2CCOCC2)N2CCOCC2)N2CCOCC2)CCO1 |
| InChI | InChI=1S/C18H32N4O4/c1-9-23-10-2-19(1)17(20-3-11-24-12-4-20)18(21-5-13-25-14-6-21)22-7-15-26-16-8-22/h1-16H2 |
| InChIKey | YRLWIKMHOJWVEN-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 49.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-(1,2,2-trimorpholin-4-ylethenyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2,2-trimorpholin-4-ylethenyl)morpholine?
The IUPAC name of 4-(1,2,2-trimorpholin-4-ylethenyl)morpholine (CID 23317607) is 4-(1,2,2-trimorpholin-4-ylethenyl)morpholine.
What is the SMILES notation for 4-(1,2,2-trimorpholin-4-ylethenyl)morpholine?
The canonical SMILES for 4-(1,2,2-trimorpholin-4-ylethenyl)morpholine is C1CN(C(=C(N2CCOCC2)N2CCOCC2)N2CCOCC2)CCO1.
What is the InChIKey of 4-(1,2,2-trimorpholin-4-ylethenyl)morpholine?
The InChIKey is YRLWIKMHOJWVEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N4O4/c1-9-23-10-2-19(1)17(20-3-11-24-12-4-20)18(21-5-13-25-14-6-21)22-7-15-26-16-8-22/h1-16H2.
What are the key properties of 4-(1,2,2-trimorpholin-4-ylethenyl)morpholine?
4-(1,2,2-trimorpholin-4-ylethenyl)morpholine has a molecular weight of 368.48 g/mol, XLogP of -0.56, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2,2-trimorpholin-4-ylethenyl)morpholine is sourced from PubChem (CID 23317607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).