About 3-methyl-2H-benzo[g][1,3]benzoselenazole
3-methyl-2H-benzo[g][1,3]benzoselenazole (PubChem CID 23317919) has the molecular formula C12H11NSe
and a molecular weight of 248.19 g/mol. Its IUPAC name is 3-methyl-2H-benzo[g][1,3]benzoselenazole.
Molecular Properties
| Compound Name | 3-methyl-2H-benzo[g][1,3]benzoselenazole |
| PubChem CID | 23317919 |
| Molecular Formula | C12H11NSe |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 3-methyl-2H-benzo[g][1,3]benzoselenazole |
| SMILES | CN1C[Se]c2c1ccc1ccccc21 |
| InChI | InChI=1S/C12H11NSe/c1-13-8-14-12-10-5-3-2-4-9(10)6-7-11(12)13/h2-7H,8H2,1H3 |
| InChIKey | HJKXLYZDWXGDRP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2H-benzo[g][1,3]benzoselenazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2H-benzo[g][1,3]benzoselenazole?
The IUPAC name of 3-methyl-2H-benzo[g][1,3]benzoselenazole (CID 23317919) is 3-methyl-2H-benzo[g][1,3]benzoselenazole.
What is the SMILES notation for 3-methyl-2H-benzo[g][1,3]benzoselenazole?
The canonical SMILES for 3-methyl-2H-benzo[g][1,3]benzoselenazole is CN1C[Se]c2c1ccc1ccccc21.
What is the InChIKey of 3-methyl-2H-benzo[g][1,3]benzoselenazole?
The InChIKey is HJKXLYZDWXGDRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NSe/c1-13-8-14-12-10-5-3-2-4-9(10)6-7-11(12)13/h2-7H,8H2,1H3.
What are the key properties of 3-methyl-2H-benzo[g][1,3]benzoselenazole?
3-methyl-2H-benzo[g][1,3]benzoselenazole has a molecular weight of 248.19 g/mol, XLogP of 1.58, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2H-benzo[g][1,3]benzoselenazole is sourced from PubChem (CID 23317919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).