About N-(3-acetylphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide
N-(3-acetylphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide (PubChem CID 2331793) has the molecular formula C27H24N2O5
and a molecular weight of 456.50 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide.
Molecular Properties
| Compound Name | N-(3-acetylphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide |
| PubChem CID | 2331793 |
| Molecular Formula | C27H24N2O5 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | N-(3-acetylphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1cc(-c2cc(C(=O)Nc3cccc(C(C)=O)c3)c3ccccc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C27H24N2O5/c1-16(30)17-8-7-9-19(12-17)28-27(31)21-15-23(29-22-11-6-5-10-20(21)22)18-13-24(32-2)26(34-4)25(14-18)33-3/h5-15H,1-4H3,(H,28,31) |
| InChIKey | RICFUAMDKSPOKF-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(3-acetylphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-acetylphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide?
The IUPAC name of N-(3-acetylphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide (CID 2331793) is N-(3-acetylphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide.
What is the SMILES notation for N-(3-acetylphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide?
The canonical SMILES for N-(3-acetylphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide is COc1cc(-c2cc(C(=O)Nc3cccc(C(C)=O)c3)c3ccccc3n2)cc(OC)c1OC.
What is the InChIKey of N-(3-acetylphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide?
The InChIKey is RICFUAMDKSPOKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24N2O5/c1-16(30)17-8-7-9-19(12-17)28-27(31)21-15-23(29-22-11-6-5-10-20(21)22)18-13-24(32-2)26(34-4)25(14-18)33-3/h5-15H,1-4H3,(H,28,31).
What are the key properties of N-(3-acetylphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide?
N-(3-acetylphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide has a molecular weight of 456.50 g/mol, XLogP of 5.38, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-acetylphenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide is sourced from PubChem (CID 2331793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).